C16H24BFN2O — CID 167368996
[(2S,3R)-3-[benzyl(methyl)amino]-2-fluoro-8-azabicyclo[3.2.1]octan-8-yl]-methylborinic acid (PubChem CID 167368996) has the molecular formula C16H24BFN2O and a molecular weight of 290.19 g/mol. Its IUPAC name is [(2S,3R)-3-[benzyl(methyl)amino]-2-fluoro-8-azabicyclo[3.2.1]octan-8-yl]-methylborinic acid.
| Compound Name | [(2S,3R)-3-[benzyl(methyl)amino]-2-fluoro-8-azabicyclo[3.2.1]octan-8-yl]-methylborinic acid |
|---|---|
| PubChem CID | 167368996 |
| Molecular Formula | C16H24BFN2O |
| Molecular Weight | 290.19 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | [(2S,3R)-3-[benzyl(methyl)amino]-2-fluoro-8-azabicyclo[3.2.1]octan-8-yl]-methylborinic acid |
| SMILES | CB(O)N1C2CCC1[C@H](F)[C@H](N(C)Cc1ccccc1)C2 |
| InChI | InChI=1S/C16H24BFN2O/c1-17(21)20-13-8-9-14(20)16(18)15(10-13)19(2)11-12-6-4-3-5-7-12/h3-7,13-16,21H,8-11H2,1-2H3/t13?,14?,15-,16+/m1/s1 |
| InChIKey | KMGNGYAIWSTCGM-FJBKBRRZSA-N |
| XLogP | 2.17 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.19 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|