C11H17BFNO — CID 174090804
[(1S,2R,3S)-3-ethynyl-2-fluoro-9-azabicyclo[3.3.1]nonan-9-yl]-methylborinic acid (PubChem CID 174090804) has the molecular formula C11H17BFNO and a molecular weight of 209.07 g/mol. Its IUPAC name is [(1S,2R,3S)-3-ethynyl-2-fluoro-9-azabicyclo[3.3.1]nonan-9-yl]-methylborinic acid.
| Compound Name | [(1S,2R,3S)-3-ethynyl-2-fluoro-9-azabicyclo[3.3.1]nonan-9-yl]-methylborinic acid |
|---|---|
| PubChem CID | 174090804 |
| Molecular Formula | C11H17BFNO |
| Molecular Weight | 209.07 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | [(1S,2R,3S)-3-ethynyl-2-fluoro-9-azabicyclo[3.3.1]nonan-9-yl]-methylborinic acid |
| SMILES | C#C[C@@H]1CC2CCC[C@@H]([C@@H]1F)N2B(C)O |
| InChI | InChI=1S/C11H17BFNO/c1-3-8-7-9-5-4-6-10(11(8)13)14(9)12(2)15/h1,8-11,15H,4-7H2,2H3/t8-,9?,10+,11-/m1/s1 |
| InChIKey | OBLPLBQZHWOOAJ-TVTJGUELSA-N |
| XLogP | 1.31 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.07 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|