About [(1R,5S)-3-(2-aminoanilino)-8-azabicyclo[3.2.1]octan-8-yl]-methylborinic acid
[(1R,5S)-3-(2-aminoanilino)-8-azabicyclo[3.2.1]octan-8-yl]-methylborinic acid (PubChem CID 59451242) has the molecular formula C14H22BN3O
and a molecular weight of 259.16 g/mol. Its IUPAC name is [(1R,5S)-3-(2-aminoanilino)-8-azabicyclo[3.2.1]octan-8-yl]-methylborinic acid.
Molecular Properties
| Compound Name | [(1R,5S)-3-(2-aminoanilino)-8-azabicyclo[3.2.1]octan-8-yl]-methylborinic acid |
| PubChem CID | 59451242 |
| Molecular Formula | C14H22BN3O |
| Molecular Weight | 259.16 g/mol |
| Exact Mass | 259.19 |
| IUPAC Name | [(1R,5S)-3-(2-aminoanilino)-8-azabicyclo[3.2.1]octan-8-yl]-methylborinic acid |
| SMILES | CB(O)N1[C@@H]2CC[C@H]1CC(Nc1ccccc1N)C2 |
| InChI | InChI=1S/C14H22BN3O/c1-15(19)18-11-6-7-12(18)9-10(8-11)17-14-5-3-2-4-13(14)16/h2-5,10-12,17,19H,6-9,16H2,1H3/t10?,11-,12+ |
| InChIKey | CAIPYNAMOUZBGY-YOGCLGLASA-N |
| XLogP | 1.79 |
| TPSA | 61.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.16 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [(1R,5S)-3-(2-aminoanilino)-8-azabicyclo[3.2.1]octan-8-yl]-methylborinic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,5S)-3-(2-aminoanilino)-8-azabicyclo[3.2.1]octan-8-yl]-methylborinic acid?
The IUPAC name of [(1R,5S)-3-(2-aminoanilino)-8-azabicyclo[3.2.1]octan-8-yl]-methylborinic acid (CID 59451242) is [(1R,5S)-3-(2-aminoanilino)-8-azabicyclo[3.2.1]octan-8-yl]-methylborinic acid.
What is the SMILES notation for [(1R,5S)-3-(2-aminoanilino)-8-azabicyclo[3.2.1]octan-8-yl]-methylborinic acid?
The canonical SMILES for [(1R,5S)-3-(2-aminoanilino)-8-azabicyclo[3.2.1]octan-8-yl]-methylborinic acid is CB(O)N1[C@@H]2CC[C@H]1CC(Nc1ccccc1N)C2.
What is the InChIKey of [(1R,5S)-3-(2-aminoanilino)-8-azabicyclo[3.2.1]octan-8-yl]-methylborinic acid?
The InChIKey is CAIPYNAMOUZBGY-YOGCLGLASA-N. The full InChI is InChI=1S/C14H22BN3O/c1-15(19)18-11-6-7-12(18)9-10(8-11)17-14-5-3-2-4-13(14)16/h2-5,10-12,17,19H,6-9,16H2,1H3/t10?,11-,12+.
What are the key properties of [(1R,5S)-3-(2-aminoanilino)-8-azabicyclo[3.2.1]octan-8-yl]-methylborinic acid?
[(1R,5S)-3-(2-aminoanilino)-8-azabicyclo[3.2.1]octan-8-yl]-methylborinic acid has a molecular weight of 259.16 g/mol, XLogP of 1.79, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,5S)-3-(2-aminoanilino)-8-azabicyclo[3.2.1]octan-8-yl]-methylborinic acid is sourced from PubChem (CID 59451242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).