C14H22BN3O — CID 59451242
[(1R,5S)-3-(2-aminoanilino)-8-azabicyclo[3.2.1]octan-8-yl]-methylborinic acid (PubChem CID 59451242) has the molecular formula C14H22BN3O and a molecular weight of 259.16 g/mol. Its IUPAC name is [(1R,5S)-3-(2-aminoanilino)-8-azabicyclo[3.2.1]octan-8-yl]-methylborinic acid.
| Compound Name | [(1R,5S)-3-(2-aminoanilino)-8-azabicyclo[3.2.1]octan-8-yl]-methylborinic acid |
|---|---|
| PubChem CID | 59451242 |
| Molecular Formula | C14H22BN3O |
| Molecular Weight | 259.16 g/mol |
| Exact Mass | 259.19 |
| IUPAC Name | [(1R,5S)-3-(2-aminoanilino)-8-azabicyclo[3.2.1]octan-8-yl]-methylborinic acid |
| SMILES | CB(O)N1[C@@H]2CC[C@H]1CC(Nc1ccccc1N)C2 |
| InChI | InChI=1S/C14H22BN3O/c1-15(19)18-11-6-7-12(18)9-10(8-11)17-14-5-3-2-4-13(14)16/h2-5,10-12,17,19H,6-9,16H2,1H3/t10?,11-,12+ |
| InChIKey | CAIPYNAMOUZBGY-YOGCLGLASA-N |
| XLogP | 1.79 |
| TPSA | 61.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.16 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|