About 3-(dibenzylamino)propyl 3-(2-aminoanilino)-8-azabicyclo[3.2.1]octane-8-carboxylate
3-(dibenzylamino)propyl 3-(2-aminoanilino)-8-azabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 159660312) has the molecular formula C31H38N4O2
and a molecular weight of 498.67 g/mol. Its IUPAC name is 3-(dibenzylamino)propyl 3-(2-aminoanilino)-8-azabicyclo[3.2.1]octane-8-carboxylate.
Molecular Properties
| Compound Name | 3-(dibenzylamino)propyl 3-(2-aminoanilino)-8-azabicyclo[3.2.1]octane-8-carboxylate |
| PubChem CID | 159660312 |
| Molecular Formula | C31H38N4O2 |
| Molecular Weight | 498.67 g/mol |
| Exact Mass | 498.30 |
| IUPAC Name | 3-(dibenzylamino)propyl 3-(2-aminoanilino)-8-azabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | Nc1ccccc1NC1CC2CCC(C1)N2C(=O)OCCCN(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C31H38N4O2/c32-29-14-7-8-15-30(29)33-26-20-27-16-17-28(21-26)35(27)31(36)37-19-9-18-34(22-24-10-3-1-4-11-24)23-25-12-5-2-6-13-25/h1-8,10-15,26-28,33H,9,16-23,32H2 |
| InChIKey | MSSGJDDKSKZCQV-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 498.67 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-(dibenzylamino)propyl 3-(2-aminoanilino)-8-azabicyclo[3.2.1]octane-8-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(dibenzylamino)propyl 3-(2-aminoanilino)-8-azabicyclo[3.2.1]octane-8-carboxylate?
The IUPAC name of 3-(dibenzylamino)propyl 3-(2-aminoanilino)-8-azabicyclo[3.2.1]octane-8-carboxylate (CID 159660312) is 3-(dibenzylamino)propyl 3-(2-aminoanilino)-8-azabicyclo[3.2.1]octane-8-carboxylate.
What is the SMILES notation for 3-(dibenzylamino)propyl 3-(2-aminoanilino)-8-azabicyclo[3.2.1]octane-8-carboxylate?
The canonical SMILES for 3-(dibenzylamino)propyl 3-(2-aminoanilino)-8-azabicyclo[3.2.1]octane-8-carboxylate is Nc1ccccc1NC1CC2CCC(C1)N2C(=O)OCCCN(Cc1ccccc1)Cc1ccccc1.
What is the InChIKey of 3-(dibenzylamino)propyl 3-(2-aminoanilino)-8-azabicyclo[3.2.1]octane-8-carboxylate?
The InChIKey is MSSGJDDKSKZCQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H38N4O2/c32-29-14-7-8-15-30(29)33-26-20-27-16-17-28(21-26)35(27)31(36)37-19-9-18-34(22-24-10-3-1-4-11-24)23-25-12-5-2-6-13-25/h1-8,10-15,26-28,33H,9,16-23,32H2.
What are the key properties of 3-(dibenzylamino)propyl 3-(2-aminoanilino)-8-azabicyclo[3.2.1]octane-8-carboxylate?
3-(dibenzylamino)propyl 3-(2-aminoanilino)-8-azabicyclo[3.2.1]octane-8-carboxylate has a molecular weight of 498.67 g/mol, XLogP of 5.91, 10 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(dibenzylamino)propyl 3-(2-aminoanilino)-8-azabicyclo[3.2.1]octane-8-carboxylate is sourced from PubChem (CID 159660312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).