C15H19N3O2 — CID 59450971
methyl (1S,5S)-3-(2-aminoanilino)-8-azabicyclo[3.2.1]oct-6-ene-8-carboxylate (PubChem CID 59450971) has the molecular formula C15H19N3O2 and a molecular weight of 273.34 g/mol. Its IUPAC name is methyl (1S,5S)-3-(2-aminoanilino)-8-azabicyclo[3.2.1]oct-6-ene-8-carboxylate.
| Compound Name | methyl (1S,5S)-3-(2-aminoanilino)-8-azabicyclo[3.2.1]oct-6-ene-8-carboxylate |
|---|---|
| PubChem CID | 59450971 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | methyl (1S,5S)-3-(2-aminoanilino)-8-azabicyclo[3.2.1]oct-6-ene-8-carboxylate |
| SMILES | COC(=O)N1[C@@H]2C=C[C@@H]1CC(Nc1ccccc1N)C2 |
| InChI | InChI=1S/C15H19N3O2/c1-20-15(19)18-11-6-7-12(18)9-10(8-11)17-14-5-3-2-4-13(14)16/h2-7,10-12,17H,8-9,16H2,1H3/t11-,12-/m1/s1 |
| InChIKey | LLUJZFYDCHIKFN-VXGBXAGGSA-N |
| XLogP | 2.22 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|