C8H11NO3 — CID 125474549
methyl (1S,5S)-3-oxa-8-azabicyclo[3.2.1]oct-6-ene-8-carboxylate (PubChem CID 125474549) has the molecular formula C8H11NO3 and a molecular weight of 169.18 g/mol. Its IUPAC name is methyl (1S,5S)-3-oxa-8-azabicyclo[3.2.1]oct-6-ene-8-carboxylate.
| Compound Name | methyl (1S,5S)-3-oxa-8-azabicyclo[3.2.1]oct-6-ene-8-carboxylate |
|---|---|
| PubChem CID | 125474549 |
| Molecular Formula | C8H11NO3 |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | methyl (1S,5S)-3-oxa-8-azabicyclo[3.2.1]oct-6-ene-8-carboxylate |
| SMILES | COC(=O)N1[C@H]2C=C[C@H]1COC2 |
| InChI | InChI=1S/C8H11NO3/c1-11-8(10)9-6-2-3-7(9)5-12-4-6/h2-3,6-7H,4-5H2,1H3/t6-,7-/m0/s1 |
| InChIKey | RNAFHIVXSAQVPH-BQBZGAKWSA-N |
| XLogP | 0.39 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|