C22H33N3 — CID 118647581
2-N-[(1S,5R)-8-[(1R,5S)-3-bicyclo[3.3.1]nonanyl]-8-azabicyclo[3.2.1]octan-3-yl]benzene-1,2-diamine (PubChem CID 118647581) has the molecular formula C22H33N3 and a molecular weight of 339.53 g/mol. Its IUPAC name is 2-N-[(1S,5R)-8-[(1R,5S)-3-bicyclo[3.3.1]nonanyl]-8-azabicyclo[3.2.1]octan-3-yl]benzene-1,2-diamine.
| Compound Name | 2-N-[(1S,5R)-8-[(1R,5S)-3-bicyclo[3.3.1]nonanyl]-8-azabicyclo[3.2.1]octan-3-yl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 118647581 |
| Molecular Formula | C22H33N3 |
| Molecular Weight | 339.53 g/mol |
| Exact Mass | 339.27 |
| IUPAC Name | 2-N-[(1S,5R)-8-[(1R,5S)-3-bicyclo[3.3.1]nonanyl]-8-azabicyclo[3.2.1]octan-3-yl]benzene-1,2-diamine |
| SMILES | Nc1ccccc1NC1C[C@H]2CC[C@@H](C1)N2C1C[C@H]2CCC[C@@H](C1)C2 |
| InChI | InChI=1S/C22H33N3/c23-21-6-1-2-7-22(21)24-17-13-18-8-9-19(14-17)25(18)20-11-15-4-3-5-16(10-15)12-20/h1-2,6-7,15-20,24H,3-5,8-14,23H2/t15-,16+,17?,18-,19+,20? |
| InChIKey | XBXIYKMCDCTVKY-BZVZFHBMSA-N |
| XLogP | 4.64 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.53 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|