C24H35N3O2 — CID 125497952
(1S,5S)-9-[(1S,5R)-7-methyl-3-bicyclo[3.3.1]nonanyl]-N-(2-nitrophenyl)-9-azabicyclo[3.3.1]nonan-3-amine (PubChem CID 125497952) has the molecular formula C24H35N3O2 and a molecular weight of 397.56 g/mol. Its IUPAC name is (1S,5S)-9-[(1S,5R)-7-methyl-3-bicyclo[3.3.1]nonanyl]-N-(2-nitrophenyl)-9-azabicyclo[3.3.1]nonan-3-amine.
| Compound Name | (1S,5S)-9-[(1S,5R)-7-methyl-3-bicyclo[3.3.1]nonanyl]-N-(2-nitrophenyl)-9-azabicyclo[3.3.1]nonan-3-amine |
|---|---|
| PubChem CID | 125497952 |
| Molecular Formula | C24H35N3O2 |
| Molecular Weight | 397.56 g/mol |
| Exact Mass | 397.27 |
| IUPAC Name | (1S,5S)-9-[(1S,5R)-7-methyl-3-bicyclo[3.3.1]nonanyl]-N-(2-nitrophenyl)-9-azabicyclo[3.3.1]nonan-3-amine |
| SMILES | CC1C[C@@H]2CC(N3[C@H]4CCC[C@H]3CC(Nc3ccccc3[N+](=O)[O-])C4)C[C@H](C1)C2 |
| InChI | InChI=1S/C24H35N3O2/c1-16-9-17-11-18(10-16)13-22(12-17)26-20-5-4-6-21(26)15-19(14-20)25-23-7-2-3-8-24(23)27(28)29/h2-3,7-8,16-22,25H,4-6,9-15H2,1H3/t16?,17-,18+,20-,21-,22?/m0/s1 |
| InChIKey | MKWMOZRIOWELKG-SBCDTRHOSA-N |
| XLogP | 5.61 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.56 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|