C22H27N3 — CID 59451134
2-N-[(1S,5R)-8-(2,3-dihydro-1H-inden-2-yl)-8-azabicyclo[3.2.1]octan-3-yl]benzene-1,2-diamine (PubChem CID 59451134) has the molecular formula C22H27N3 and a molecular weight of 333.48 g/mol. Its IUPAC name is 2-N-[(1S,5R)-8-(2,3-dihydro-1H-inden-2-yl)-8-azabicyclo[3.2.1]octan-3-yl]benzene-1,2-diamine.
| Compound Name | 2-N-[(1S,5R)-8-(2,3-dihydro-1H-inden-2-yl)-8-azabicyclo[3.2.1]octan-3-yl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 59451134 |
| Molecular Formula | C22H27N3 |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.22 |
| IUPAC Name | 2-N-[(1S,5R)-8-(2,3-dihydro-1H-inden-2-yl)-8-azabicyclo[3.2.1]octan-3-yl]benzene-1,2-diamine |
| SMILES | Nc1ccccc1NC1C[C@H]2CC[C@@H](C1)N2C1Cc2ccccc2C1 |
| InChI | InChI=1S/C22H27N3/c23-21-7-3-4-8-22(21)24-17-13-18-9-10-19(14-17)25(18)20-11-15-5-1-2-6-16(15)12-20/h1-8,17-20,24H,9-14,23H2/t17?,18-,19+ |
| InChIKey | RLZRQYFEGCLRNK-YQQQUEKLSA-N |
| XLogP | 3.84 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|