C23H35N3O — CID 90264682
2-N-[(1R,5S)-9-(8-bicyclo[4.3.1]decanyl)-3-oxa-9-azabicyclo[3.3.1]nonan-7-yl]benzene-1,2-diamine (PubChem CID 90264682) has the molecular formula C23H35N3O and a molecular weight of 369.55 g/mol. Its IUPAC name is 2-N-[(1R,5S)-9-(8-bicyclo[4.3.1]decanyl)-3-oxa-9-azabicyclo[3.3.1]nonan-7-yl]benzene-1,2-diamine.
| Compound Name | 2-N-[(1R,5S)-9-(8-bicyclo[4.3.1]decanyl)-3-oxa-9-azabicyclo[3.3.1]nonan-7-yl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 90264682 |
| Molecular Formula | C23H35N3O |
| Molecular Weight | 369.55 g/mol |
| Exact Mass | 369.28 |
| IUPAC Name | 2-N-[(1R,5S)-9-(8-bicyclo[4.3.1]decanyl)-3-oxa-9-azabicyclo[3.3.1]nonan-7-yl]benzene-1,2-diamine |
| SMILES | Nc1ccccc1NC1C[C@H]2COC[C@@H](C1)N2C1CC2CCCCC(C2)C1 |
| InChI | InChI=1S/C23H35N3O/c24-22-7-3-4-8-23(22)25-18-12-20-14-27-15-21(13-18)26(20)19-10-16-5-1-2-6-17(9-16)11-19/h3-4,7-8,16-21,25H,1-2,5-6,9-15,24H2/t16?,17?,18?,19?,20-,21+ |
| InChIKey | PXSUEQNYFHUBFP-MDWLPXDISA-N |
| XLogP | 4.27 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.55 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|