C12H19BN2O2 — CID 20765939
[4-(2-hydroxyanilino)piperidin-1-yl]-methylborinic acid (PubChem CID 20765939) has the molecular formula C12H19BN2O2 and a molecular weight of 234.11 g/mol. Its IUPAC name is [4-(2-hydroxyanilino)piperidin-1-yl]-methylborinic acid.
| Compound Name | [4-(2-hydroxyanilino)piperidin-1-yl]-methylborinic acid |
|---|---|
| PubChem CID | 20765939 |
| Molecular Formula | C12H19BN2O2 |
| Molecular Weight | 234.11 g/mol |
| Exact Mass | 234.15 |
| IUPAC Name | [4-(2-hydroxyanilino)piperidin-1-yl]-methylborinic acid |
| SMILES | CB(O)N1CCC(Nc2ccccc2O)CC1 |
| InChI | InChI=1S/C12H19BN2O2/c1-13(17)15-8-6-10(7-9-15)14-11-4-2-3-5-12(11)16/h2-5,10,14,16-17H,6-9H2,1H3 |
| InChIKey | JWQJMWLKQCGQNG-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.11 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|