C26H25N3O3 — CID 24985384
2-[4-(2-hydroxyanilino)piperidin-1-yl]-N-(9-oxofluoren-3-yl)acetamide (PubChem CID 24985384) has the molecular formula C26H25N3O3 and a molecular weight of 427.50 g/mol. Its IUPAC name is 2-[4-(2-hydroxyanilino)piperidin-1-yl]-N-(9-oxofluoren-3-yl)acetamide.
| Compound Name | 2-[4-(2-hydroxyanilino)piperidin-1-yl]-N-(9-oxofluoren-3-yl)acetamide |
|---|---|
| PubChem CID | 24985384 |
| Molecular Formula | C26H25N3O3 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | 2-[4-(2-hydroxyanilino)piperidin-1-yl]-N-(9-oxofluoren-3-yl)acetamide |
| SMILES | O=C(CN1CCC(Nc2ccccc2O)CC1)Nc1ccc2c(c1)-c1ccccc1C2=O |
| InChI | InChI=1S/C26H25N3O3/c30-24-8-4-3-7-23(24)27-17-11-13-29(14-12-17)16-25(31)28-18-9-10-21-22(15-18)19-5-1-2-6-20(19)26(21)32/h1-10,15,17,27,30H,11-14,16H2,(H,28,31) |
| InChIKey | LLHZUGRKVDEZEM-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|