C8H16BFN2O — CID 167370040
[(5R,6S)-5-amino-6-fluoro-2-azabicyclo[2.2.2]octan-2-yl]-methylborinic acid (PubChem CID 167370040) has the molecular formula C8H16BFN2O and a molecular weight of 186.04 g/mol. Its IUPAC name is [(5R,6S)-5-amino-6-fluoro-2-azabicyclo[2.2.2]octan-2-yl]-methylborinic acid.
| Compound Name | [(5R,6S)-5-amino-6-fluoro-2-azabicyclo[2.2.2]octan-2-yl]-methylborinic acid |
|---|---|
| PubChem CID | 167370040 |
| Molecular Formula | C8H16BFN2O |
| Molecular Weight | 186.04 g/mol |
| Exact Mass | 186.13 |
| IUPAC Name | [(5R,6S)-5-amino-6-fluoro-2-azabicyclo[2.2.2]octan-2-yl]-methylborinic acid |
| SMILES | CB(O)N1CC2CCC1[C@@H](F)[C@@H]2N |
| InChI | InChI=1S/C8H16BFN2O/c1-9(13)12-4-5-2-3-6(12)7(10)8(5)11/h5-8,13H,2-4,11H2,1H3/t5?,6?,7-,8-/m1/s1 |
| InChIKey | ZMOHXRNBHSZYMT-DWYQZRHDSA-N |
| XLogP | -0.14 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.04 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|