C23H29NO — CID 59074949
(4S)-N-[(1R)-1-naphthalen-2-ylethyl]spiro[4.5]decane-4-carboxamide (PubChem CID 59074949) has the molecular formula C23H29NO and a molecular weight of 335.49 g/mol. Its IUPAC name is (4S)-N-[(1R)-1-naphthalen-2-ylethyl]spiro[4.5]decane-4-carboxamide.
| Compound Name | (4S)-N-[(1R)-1-naphthalen-2-ylethyl]spiro[4.5]decane-4-carboxamide |
|---|---|
| PubChem CID | 59074949 |
| Molecular Formula | C23H29NO |
| Molecular Weight | 335.49 g/mol |
| Exact Mass | 335.22 |
| IUPAC Name | (4S)-N-[(1R)-1-naphthalen-2-ylethyl]spiro[4.5]decane-4-carboxamide |
| SMILES | C[C@@H](NC(=O)[C@H]1CCCC12CCCCC2)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C23H29NO/c1-17(19-12-11-18-8-3-4-9-20(18)16-19)24-22(25)21-10-7-15-23(21)13-5-2-6-14-23/h3-4,8-9,11-12,16-17,21H,2,5-7,10,13-15H2,1H3,(H,24,25)/t17-,21-/m1/s1 |
| InChIKey | HSAMYWLCLAGDMS-DYESRHJHSA-N |
| XLogP | 5.77 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.49 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |