C14H26N2O — CID 59075638
(E)-N,5-dimethyl-2-[(2R)-2-methylpiperidin-1-yl]hex-3-enamide (PubChem CID 59075638) has the molecular formula C14H26N2O and a molecular weight of 238.38 g/mol. Its IUPAC name is (E)-N,5-dimethyl-2-[(2R)-2-methylpiperidin-1-yl]hex-3-enamide.
| Compound Name | (E)-N,5-dimethyl-2-[(2R)-2-methylpiperidin-1-yl]hex-3-enamide |
|---|---|
| PubChem CID | 59075638 |
| Molecular Formula | C14H26N2O |
| Molecular Weight | 238.38 g/mol |
| Exact Mass | 238.20 |
| IUPAC Name | (E)-N,5-dimethyl-2-[(2R)-2-methylpiperidin-1-yl]hex-3-enamide |
| SMILES | CNC(=O)C(/C=C/C(C)C)N1CCCC[C@H]1C |
| InChI | InChI=1S/C14H26N2O/c1-11(2)8-9-13(14(17)15-4)16-10-6-5-7-12(16)3/h8-9,11-13H,5-7,10H2,1-4H3,(H,15,17)/b9-8+/t12-,13?/m1/s1 |
| InChIKey | ZDZRZAHOTWHTCT-KAWPKLPBSA-N |
| XLogP | 2.19 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.38 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|