C10H15N3 — CID 59076562
(3S,4S,5S)-5-azido-3-ethenyl-1,4-dimethylcyclohexene (PubChem CID 59076562) has the molecular formula C10H15N3 and a molecular weight of 177.25 g/mol. Its IUPAC name is (3S,4S,5S)-5-azido-3-ethenyl-1,4-dimethylcyclohexene.
| Compound Name | (3S,4S,5S)-5-azido-3-ethenyl-1,4-dimethylcyclohexene |
|---|---|
| PubChem CID | 59076562 |
| Molecular Formula | C10H15N3 |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.13 |
| IUPAC Name | (3S,4S,5S)-5-azido-3-ethenyl-1,4-dimethylcyclohexene |
| SMILES | C=C[C@H]1C=C(C)C[C@H](N=[N+]=[N-])[C@H]1C |
| InChI | InChI=1S/C10H15N3/c1-4-9-5-7(2)6-10(8(9)3)12-13-11/h4-5,8-10H,1,6H2,2-3H3/t8-,9-,10-/m0/s1 |
| InChIKey | FWZHRCWGIYTYFF-GUBZILKMSA-N |
| XLogP | 3.45 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|