C9H13BrO3 — CID 59076583
[(1S,2S,6R)-2-bromo-4-methyl-6-tritiooxycyclohex-3-en-1-yl] acetate (PubChem CID 59076583) has the molecular formula C9H13BrO3 and a molecular weight of 251.11 g/mol. Its IUPAC name is [(1S,2S,6R)-2-bromo-4-methyl-6-tritiooxycyclohex-3-en-1-yl] acetate.
| Compound Name | [(1S,2S,6R)-2-bromo-4-methyl-6-tritiooxycyclohex-3-en-1-yl] acetate |
|---|---|
| PubChem CID | 59076583 |
| Molecular Formula | C9H13BrO3 |
| Molecular Weight | 251.11 g/mol |
| Exact Mass | 250.01 |
| IUPAC Name | [(1S,2S,6R)-2-bromo-4-methyl-6-tritiooxycyclohex-3-en-1-yl] acetate |
| SMILES | [3H]O[C@@H]1CC(C)=C[C@H](Br)[C@H]1OC(C)=O |
| InChI | InChI=1S/C9H13BrO3/c1-5-3-7(10)9(8(12)4-5)13-6(2)11/h3,7-9,12H,4H2,1-2H3/t7-,8+,9+/m0/s1/i12T |
| InChIKey | ZATMEHTZYFVANA-CYSQWZQZSA-N |
| XLogP | 1.39 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.11 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|