C10H18BBrO3S — CID 159000571
[(1S,2S,6R)-2-bromo-4-methyl-6-tritiooxycyclohex-3-en-1-yl] acetate;deuterio(methyl)borinothioic acid (PubChem CID 159000571) has the molecular formula C10H18BBrO3S and a molecular weight of 312.05 g/mol. Its IUPAC name is [(1S,2S,6R)-2-bromo-4-methyl-6-tritiooxycyclohex-3-en-1-yl] acetate;deuterio(methyl)borinothioic acid.
| Compound Name | [(1S,2S,6R)-2-bromo-4-methyl-6-tritiooxycyclohex-3-en-1-yl] acetate;deuterio(methyl)borinothioic acid |
|---|---|
| PubChem CID | 159000571 |
| Molecular Formula | C10H18BBrO3S |
| Molecular Weight | 312.05 g/mol |
| Exact Mass | 311.04 |
| IUPAC Name | [(1S,2S,6R)-2-bromo-4-methyl-6-tritiooxycyclohex-3-en-1-yl] acetate;deuterio(methyl)borinothioic acid |
| SMILES | [2H]B(C)S.[3H]O[C@@H]1CC(C)=C[C@H](Br)[C@H]1OC(C)=O |
| InChI | InChI=1S/C9H13BrO3.CH5BS/c1-5-3-7(10)9(8(12)4-5)13-6(2)11;1-2-3/h3,7-9,12H,4H2,1-2H3;2-3H,1H3/t7-,8+,9+;/m0./s1/i12T;2D |
| InChIKey | JRHFSFNYZXVKDR-RJIACKRTSA-N |
| XLogP | 1.71 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.05 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|