C30H48O8 — CID 59078343
(2R,3S,4E,7R,10R,11R,13R)-2-ethyl-3-hydroxy-5,7,9,9,11,13-hexamethyl-6,12,14-trioxo-10-[(3R,4S,6R)-3,4,6-trimethyloxan-2-yl]oxy-1-oxacyclotetradec-4-ene-3-carbaldehyde (PubChem CID 59078343) has the molecular formula C30H48O8 and a molecular weight of 536.71 g/mol. Its IUPAC name is (2R,3S,4E,7R,10R,11R,13R)-2-ethyl-3-hydroxy-5,7,9,9,11,13-hexamethyl-6,12,14-trioxo-10-[(3R,4S,6R)-3,4,6-trimethyloxan-2-yl]oxy-1-oxacyclotetradec-4-ene-3-carbaldehyde.
| Compound Name | (2R,3S,4E,7R,10R,11R,13R)-2-ethyl-3-hydroxy-5,7,9,9,11,13-hexamethyl-6,12,14-trioxo-10-[(3R,4S,6R)-3,4,6-trimethyloxan-2-yl]oxy-1-oxacyclotetradec-4-ene-3-carbaldehyde |
|---|---|
| PubChem CID | 59078343 |
| Molecular Formula | C30H48O8 |
| Molecular Weight | 536.71 g/mol |
| Exact Mass | 536.33 |
| IUPAC Name | (2R,3S,4E,7R,10R,11R,13R)-2-ethyl-3-hydroxy-5,7,9,9,11,13-hexamethyl-6,12,14-trioxo-10-[(3R,4S,6R)-3,4,6-trimethyloxan-2-yl]oxy-1-oxacyclotetradec-4-ene-3-carbaldehyde |
| SMILES | CC[C@H]1OC(=O)[C@H](C)C(=O)[C@H](C)[C@@H](OC2O[C@H](C)C[C@H](C)[C@H]2C)C(C)(C)C[C@@H](C)C(=O)/C(C)=C/[C@@]1(O)C=O |
| InChI | InChI=1S/C30H48O8/c1-11-23-30(35,15-31)14-18(4)24(32)17(3)13-29(9,10)26(21(7)25(33)22(8)27(34)37-23)38-28-20(6)16(2)12-19(5)36-28/h14-17,19-23,26,28,35H,11-13H2,1-10H3/b18-14+/t16-,17+,19+,20+,21-,22+,23+,26+,28?,30+/m0/s1 |
| InChIKey | IVJRJLKWEZOQRS-NNNSCHTOSA-N |
| XLogP | 4.45 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.71 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|