C29H47FO7 — CID 59078290
(3S,5R,6R,9R,11E,13S,14R)-14-ethyl-3-fluoro-13-hydroxy-3,5,7,7,9,11-hexamethyl-6-[(3R,4S,6R)-3,4,6-trimethyloxan-2-yl]oxy-1-oxacyclotetradec-11-ene-2,4,10-trione (PubChem CID 59078290) has the molecular formula C29H47FO7 and a molecular weight of 526.69 g/mol. Its IUPAC name is (3S,5R,6R,9R,11E,13S,14R)-14-ethyl-3-fluoro-13-hydroxy-3,5,7,7,9,11-hexamethyl-6-[(3R,4S,6R)-3,4,6-trimethyloxan-2-yl]oxy-1-oxacyclotetradec-11-ene-2,4,10-trione.
| Compound Name | (3S,5R,6R,9R,11E,13S,14R)-14-ethyl-3-fluoro-13-hydroxy-3,5,7,7,9,11-hexamethyl-6-[(3R,4S,6R)-3,4,6-trimethyloxan-2-yl]oxy-1-oxacyclotetradec-11-ene-2,4,10-trione |
|---|---|
| PubChem CID | 59078290 |
| Molecular Formula | C29H47FO7 |
| Molecular Weight | 526.69 g/mol |
| Exact Mass | 526.33 |
| IUPAC Name | (3S,5R,6R,9R,11E,13S,14R)-14-ethyl-3-fluoro-13-hydroxy-3,5,7,7,9,11-hexamethyl-6-[(3R,4S,6R)-3,4,6-trimethyloxan-2-yl]oxy-1-oxacyclotetradec-11-ene-2,4,10-trione |
| SMILES | CC[C@H]1OC(=O)[C@@](C)(F)C(=O)[C@H](C)[C@@H](OC2O[C@H](C)C[C@H](C)[C@H]2C)C(C)(C)C[C@@H](C)C(=O)/C(C)=C/[C@@H]1O |
| InChI | InChI=1S/C29H47FO7/c1-11-22-21(31)13-16(3)23(32)17(4)14-28(8,9)25(20(7)24(33)29(10,30)27(34)36-22)37-26-19(6)15(2)12-18(5)35-26/h13,15,17-22,25-26,31H,11-12,14H2,1-10H3/b16-13+/t15-,17+,18+,19+,20-,21-,22+,25+,26?,29-/m0/s1 |
| InChIKey | IOAKXDNMMRSJHE-ADDVTTRMSA-N |
| XLogP | 4.98 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.69 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|