C18H10ClN4O4S- — CID 59082031
9-(benzenesulfonyl)-6-chloro-2-phenylpurine-8-carboxylate (PubChem CID 59082031) has the molecular formula C18H10ClN4O4S- and a molecular weight of 413.82 g/mol. Its IUPAC name is 9-(benzenesulfonyl)-6-chloro-2-phenylpurine-8-carboxylate.
| Compound Name | 9-(benzenesulfonyl)-6-chloro-2-phenylpurine-8-carboxylate |
|---|---|
| PubChem CID | 59082031 |
| Molecular Formula | C18H10ClN4O4S- |
| Molecular Weight | 413.82 g/mol |
| Exact Mass | 413.01 |
| IUPAC Name | 9-(benzenesulfonyl)-6-chloro-2-phenylpurine-8-carboxylate |
| SMILES | O=C([O-])c1nc2c(Cl)nc(-c3ccccc3)nc2n1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C18H11ClN4O4S/c19-14-13-16(22-15(21-14)11-7-3-1-4-8-11)23(17(20-13)18(24)25)28(26,27)12-9-5-2-6-10-12/h1-10H,(H,24,25)/p-1 |
| InChIKey | KSHOTCFOBFMNLH-UHFFFAOYSA-M |
| XLogP | 1.75 |
| TPSA | 117.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.82 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |