C25H34O6 — CID 59083539
(2-methyl-4-oxopentan-2-yl) 9-methyl-10-(4-methyl-2,5-dioxooxolan-3-yl)tetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate (PubChem CID 59083539) has the molecular formula C25H34O6 and a molecular weight of 430.54 g/mol. Its IUPAC name is (2-methyl-4-oxopentan-2-yl) 9-methyl-10-(4-methyl-2,5-dioxooxolan-3-yl)tetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate.
| Compound Name | (2-methyl-4-oxopentan-2-yl) 9-methyl-10-(4-methyl-2,5-dioxooxolan-3-yl)tetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate |
|---|---|
| PubChem CID | 59083539 |
| Molecular Formula | C25H34O6 |
| Molecular Weight | 430.54 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | (2-methyl-4-oxopentan-2-yl) 9-methyl-10-(4-methyl-2,5-dioxooxolan-3-yl)tetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate |
| SMILES | CC(=O)CC(C)(C)OC(=O)C1CC2CC1C1C3CC(C(C)C3C3C(=O)OC(=O)C3C)C21 |
| InChI | InChI=1S/C25H34O6/c1-10(26)9-25(4,5)31-23(28)16-7-13-6-15(16)21-17-8-14(20(13)21)11(2)18(17)19-12(3)22(27)30-24(19)29/h11-21H,6-9H2,1-5H3 |
| InChIKey | AOSAJRFNDYUDIS-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.54 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|