C25H34O9 — CID 20707341
5-[6-(dimethoxymethyl)-3-(4-methyl-2,5-dioxooxolan-3-yl)-2-bicyclo[2.2.1]heptanyl]-6-methylbicyclo[2.2.1]heptane-2,3-dicarboxylic acid (PubChem CID 20707341) has the molecular formula C25H34O9 and a molecular weight of 478.54 g/mol. Its IUPAC name is 5-[6-(dimethoxymethyl)-3-(4-methyl-2,5-dioxooxolan-3-yl)-2-bicyclo[2.2.1]heptanyl]-6-methylbicyclo[2.2.1]heptane-2,3-dicarboxylic acid.
| Compound Name | 5-[6-(dimethoxymethyl)-3-(4-methyl-2,5-dioxooxolan-3-yl)-2-bicyclo[2.2.1]heptanyl]-6-methylbicyclo[2.2.1]heptane-2,3-dicarboxylic acid |
|---|---|
| PubChem CID | 20707341 |
| Molecular Formula | C25H34O9 |
| Molecular Weight | 478.54 g/mol |
| Exact Mass | 478.22 |
| IUPAC Name | 5-[6-(dimethoxymethyl)-3-(4-methyl-2,5-dioxooxolan-3-yl)-2-bicyclo[2.2.1]heptanyl]-6-methylbicyclo[2.2.1]heptane-2,3-dicarboxylic acid |
| SMILES | COC(OC)C1CC2CC1C(C1C(C)C3CC1C(C(=O)O)C3C(=O)O)C2C1C(=O)OC(=O)C1C |
| InChI | InChI=1S/C25H34O9/c1-8-11-7-14(20(22(28)29)19(11)21(26)27)15(8)18-12-5-10(6-13(12)25(32-3)33-4)17(18)16-9(2)23(30)34-24(16)31/h8-20,25H,5-7H2,1-4H3,(H,26,27)(H,28,29) |
| InChIKey | MRGFSGRHFDJJJB-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 136.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.54 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|