C15H24N2 — CID 59085007
3-[[(2S)-1-(3-methylbutyl)pyrrolidin-2-yl]methyl]pyridine (PubChem CID 59085007) has the molecular formula C15H24N2 and a molecular weight of 232.37 g/mol. Its IUPAC name is 3-[[(2S)-1-(3-methylbutyl)pyrrolidin-2-yl]methyl]pyridine.
| Compound Name | 3-[[(2S)-1-(3-methylbutyl)pyrrolidin-2-yl]methyl]pyridine |
|---|---|
| PubChem CID | 59085007 |
| Molecular Formula | C15H24N2 |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.19 |
| IUPAC Name | 3-[[(2S)-1-(3-methylbutyl)pyrrolidin-2-yl]methyl]pyridine |
| SMILES | CC(C)CCN1CCC[C@H]1Cc1cccnc1 |
| InChI | InChI=1S/C15H24N2/c1-13(2)7-10-17-9-4-6-15(17)11-14-5-3-8-16-12-14/h3,5,8,12-13,15H,4,6-7,9-11H2,1-2H3/t15-/m0/s1 |
| InChIKey | ZYBDTQHWOWBFDZ-HNNXBMFYSA-N |
| XLogP | 3.13 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |