C14H22N2O2S — CID 95845766
3-[[(3R)-1-propan-2-ylsulfonylpiperidin-3-yl]methyl]pyridine (PubChem CID 95845766) has the molecular formula C14H22N2O2S and a molecular weight of 282.41 g/mol. Its IUPAC name is 3-[[(3R)-1-propan-2-ylsulfonylpiperidin-3-yl]methyl]pyridine.
| Compound Name | 3-[[(3R)-1-propan-2-ylsulfonylpiperidin-3-yl]methyl]pyridine |
|---|---|
| PubChem CID | 95845766 |
| Molecular Formula | C14H22N2O2S |
| Molecular Weight | 282.41 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | 3-[[(3R)-1-propan-2-ylsulfonylpiperidin-3-yl]methyl]pyridine |
| SMILES | CC(C)S(=O)(=O)N1CCC[C@H](Cc2cccnc2)C1 |
| InChI | InChI=1S/C14H22N2O2S/c1-12(2)19(17,18)16-8-4-6-14(11-16)9-13-5-3-7-15-10-13/h3,5,7,10,12,14H,4,6,8-9,11H2,1-2H3/t14-/m1/s1 |
| InChIKey | ISVQZKQWAXYYHS-CQSZACIVSA-N |
| XLogP | 2.07 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.41 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |