C20H25F2N3O — CID 59087962
2-[(4-tert-butylphenyl)methyl]-1-[2-(3,4-difluorophenyl)ethyl]-3-hydroxyguanidine (PubChem CID 59087962) has the molecular formula C20H25F2N3O and a molecular weight of 361.44 g/mol. Its IUPAC name is 2-[(4-tert-butylphenyl)methyl]-1-[2-(3,4-difluorophenyl)ethyl]-3-hydroxyguanidine.
| Compound Name | 2-[(4-tert-butylphenyl)methyl]-1-[2-(3,4-difluorophenyl)ethyl]-3-hydroxyguanidine |
|---|---|
| PubChem CID | 59087962 |
| Molecular Formula | C20H25F2N3O |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.20 |
| IUPAC Name | 2-[(4-tert-butylphenyl)methyl]-1-[2-(3,4-difluorophenyl)ethyl]-3-hydroxyguanidine |
| SMILES | CC(C)(C)c1ccc(C/N=C(\NO)NCCc2ccc(F)c(F)c2)cc1 |
| InChI | InChI=1S/C20H25F2N3O/c1-20(2,3)16-7-4-15(5-8-16)13-24-19(25-26)23-11-10-14-6-9-17(21)18(22)12-14/h4-9,12,26H,10-11,13H2,1-3H3,(H2,23,24,25) |
| InChIKey | YBENXIILFGZCGL-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|