C25H24Cl2N2O3 — CID 59093148
(4R,5S)-4,5-bis(4-chlorophenyl)-2-[4-methoxy-2-(1-methoxyethoxy)phenyl]-4,5-dihydro-1H-imidazole (PubChem CID 59093148) has the molecular formula C25H24Cl2N2O3 and a molecular weight of 471.38 g/mol. Its IUPAC name is (4R,5S)-4,5-bis(4-chlorophenyl)-2-[4-methoxy-2-(1-methoxyethoxy)phenyl]-4,5-dihydro-1H-imidazole.
| Compound Name | (4R,5S)-4,5-bis(4-chlorophenyl)-2-[4-methoxy-2-(1-methoxyethoxy)phenyl]-4,5-dihydro-1H-imidazole |
|---|---|
| PubChem CID | 59093148 |
| Molecular Formula | C25H24Cl2N2O3 |
| Molecular Weight | 471.38 g/mol |
| Exact Mass | 470.12 |
| IUPAC Name | (4R,5S)-4,5-bis(4-chlorophenyl)-2-[4-methoxy-2-(1-methoxyethoxy)phenyl]-4,5-dihydro-1H-imidazole |
| SMILES | COc1ccc(C2=N[C@H](c3ccc(Cl)cc3)[C@H](c3ccc(Cl)cc3)N2)c(OC(C)OC)c1 |
| InChI | InChI=1S/C25H24Cl2N2O3/c1-15(30-2)32-22-14-20(31-3)12-13-21(22)25-28-23(16-4-8-18(26)9-5-16)24(29-25)17-6-10-19(27)11-7-17/h4-15,23-24H,1-3H3,(H,28,29)/t15?,23-,24+ |
| InChIKey | CBZHIFOCNZRVGN-RLDSBTEXSA-N |
| XLogP | 6.21 |
| TPSA | 52.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.38 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|