C16H24N2O — CID 59094751
(1R,2R)-2-[(cyclohexylideneamino)-methylamino]-1-phenylpropan-1-ol (PubChem CID 59094751) has the molecular formula C16H24N2O and a molecular weight of 260.38 g/mol. Its IUPAC name is (1R,2R)-2-[(cyclohexylideneamino)-methylamino]-1-phenylpropan-1-ol.
| Compound Name | (1R,2R)-2-[(cyclohexylideneamino)-methylamino]-1-phenylpropan-1-ol |
|---|---|
| PubChem CID | 59094751 |
| Molecular Formula | C16H24N2O |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | (1R,2R)-2-[(cyclohexylideneamino)-methylamino]-1-phenylpropan-1-ol |
| SMILES | C[C@H]([C@H](O)c1ccccc1)N(C)N=C1CCCCC1 |
| InChI | InChI=1S/C16H24N2O/c1-13(16(19)14-9-5-3-6-10-14)18(2)17-15-11-7-4-8-12-15/h3,5-6,9-10,13,16,19H,4,7-8,11-12H2,1-2H3/t13-,16+/m1/s1 |
| InChIKey | HARSYLKUECRFRT-CJNGLKHVSA-N |
| XLogP | 3.36 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|