About CID 59094786
CID 59094786 (PubChem CID 59094786) has the molecular formula C9H18
and a molecular weight of 126.24 g/mol.
Molecular Properties
| Compound Name | CID 59094786 |
| PubChem CID | 59094786 |
| Molecular Formula | C9H18 |
| Molecular Weight | 126.24 g/mol |
| Exact Mass | 126.14 |
| IUPAC Name | — |
| SMILES | [CH]CCC(C)CCCC |
| InChI | InChI=1S/C9H18/c1-4-6-8-9(3)7-5-2/h2,9H,4-8H2,1,3H3 |
| InChIKey | PIFZQACIPSQFOV-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.24 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 59094786 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59094786?
The IUPAC name of CID 59094786 (CID 59094786) is not available.
What is the SMILES notation for CID 59094786?
The canonical SMILES for CID 59094786 is [CH]CCC(C)CCCC.
What is the InChIKey of CID 59094786?
The InChIKey is PIFZQACIPSQFOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18/c1-4-6-8-9(3)7-5-2/h2,9H,4-8H2,1,3H3.
What are the key properties of CID 59094786?
CID 59094786 has a molecular weight of 126.24 g/mol, XLogP of 3.30, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59094786 is sourced from PubChem (CID 59094786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).