About 4-butan-2-ylbicyclo[4.2.0]octa-1(6),2,4-trien-7-amine
4-butan-2-ylbicyclo[4.2.0]octa-1(6),2,4-trien-7-amine (PubChem CID 59095390) has the molecular formula C12H17N
and a molecular weight of 175.27 g/mol. Its IUPAC name is 4-butan-2-ylbicyclo[4.2.0]octa-1(6),2,4-trien-7-amine.
Analyze 4-butan-2-ylbicyclo[4.2.0]octa-1(6),2,4-trien-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butan-2-ylbicyclo[4.2.0]octa-1(6),2,4-trien-7-amine?
The IUPAC name of 4-butan-2-ylbicyclo[4.2.0]octa-1(6),2,4-trien-7-amine (CID 59095390) is 4-butan-2-ylbicyclo[4.2.0]octa-1(6),2,4-trien-7-amine.
What is the SMILES notation for 4-butan-2-ylbicyclo[4.2.0]octa-1(6),2,4-trien-7-amine?
The canonical SMILES for 4-butan-2-ylbicyclo[4.2.0]octa-1(6),2,4-trien-7-amine is CCC(C)c1ccc2c(c1)C(N)C2.
What is the InChIKey of 4-butan-2-ylbicyclo[4.2.0]octa-1(6),2,4-trien-7-amine?
The InChIKey is MCKVUHCISNDNGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N/c1-3-8(2)9-4-5-10-7-12(13)11(10)6-9/h4-6,8,12H,3,7,13H2,1-2H3.
What are the key properties of 4-butan-2-ylbicyclo[4.2.0]octa-1(6),2,4-trien-7-amine?
4-butan-2-ylbicyclo[4.2.0]octa-1(6),2,4-trien-7-amine has a molecular weight of 175.27 g/mol, XLogP of 2.76, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butan-2-ylbicyclo[4.2.0]octa-1(6),2,4-trien-7-amine is sourced from PubChem (CID 59095390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).