C12H16O — CID 59095378
4-butan-2-ylbicyclo[4.2.0]octa-1(6),2,4-trien-7-ol (PubChem CID 59095378) has the molecular formula C12H16O and a molecular weight of 176.26 g/mol. Its IUPAC name is 4-butan-2-ylbicyclo[4.2.0]octa-1(6),2,4-trien-7-ol.
| Compound Name | 4-butan-2-ylbicyclo[4.2.0]octa-1(6),2,4-trien-7-ol |
|---|---|
| PubChem CID | 59095378 |
| Molecular Formula | C12H16O |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.12 |
| IUPAC Name | 4-butan-2-ylbicyclo[4.2.0]octa-1(6),2,4-trien-7-ol |
| SMILES | CCC(C)c1ccc2c(c1)C(O)C2 |
| InChI | InChI=1S/C12H16O/c1-3-8(2)9-4-5-10-7-12(13)11(10)6-9/h4-6,8,12-13H,3,7H2,1-2H3 |
| InChIKey | LNJPKUIHRODEQO-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |