About 6-butan-2-yl-3,3-dimethyl-2H-inden-1-one
6-butan-2-yl-3,3-dimethyl-2H-inden-1-one (PubChem CID 79837924) has the molecular formula C15H20O
and a molecular weight of 216.32 g/mol. Its IUPAC name is 6-butan-2-yl-3,3-dimethyl-2H-inden-1-one.
Molecular Properties
| Compound Name | 6-butan-2-yl-3,3-dimethyl-2H-inden-1-one |
| PubChem CID | 79837924 |
| Molecular Formula | C15H20O |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | 6-butan-2-yl-3,3-dimethyl-2H-inden-1-one |
| SMILES | CCC(C)c1ccc2c(c1)C(=O)CC2(C)C |
| InChI | InChI=1S/C15H20O/c1-5-10(2)11-6-7-13-12(8-11)14(16)9-15(13,3)4/h6-8,10H,5,9H2,1-4H3 |
| InChIKey | DMTARSKYAWNGRR-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-butan-2-yl-3,3-dimethyl-2H-inden-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-butan-2-yl-3,3-dimethyl-2H-inden-1-one?
The IUPAC name of 6-butan-2-yl-3,3-dimethyl-2H-inden-1-one (CID 79837924) is 6-butan-2-yl-3,3-dimethyl-2H-inden-1-one.
What is the SMILES notation for 6-butan-2-yl-3,3-dimethyl-2H-inden-1-one?
The canonical SMILES for 6-butan-2-yl-3,3-dimethyl-2H-inden-1-one is CCC(C)c1ccc2c(c1)C(=O)CC2(C)C.
What is the InChIKey of 6-butan-2-yl-3,3-dimethyl-2H-inden-1-one?
The InChIKey is DMTARSKYAWNGRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20O/c1-5-10(2)11-6-7-13-12(8-11)14(16)9-15(13,3)4/h6-8,10H,5,9H2,1-4H3.
What are the key properties of 6-butan-2-yl-3,3-dimethyl-2H-inden-1-one?
6-butan-2-yl-3,3-dimethyl-2H-inden-1-one has a molecular weight of 216.32 g/mol, XLogP of 4.06, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-butan-2-yl-3,3-dimethyl-2H-inden-1-one is sourced from PubChem (CID 79837924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).