C15H20O — CID 79837924
6-butan-2-yl-3,3-dimethyl-2H-inden-1-one (PubChem CID 79837924) has the molecular formula C15H20O and a molecular weight of 216.32 g/mol. Its IUPAC name is 6-butan-2-yl-3,3-dimethyl-2H-inden-1-one.
| Compound Name | 6-butan-2-yl-3,3-dimethyl-2H-inden-1-one |
|---|---|
| PubChem CID | 79837924 |
| Molecular Formula | C15H20O |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | 6-butan-2-yl-3,3-dimethyl-2H-inden-1-one |
| SMILES | CCC(C)c1ccc2c(c1)C(=O)CC2(C)C |
| InChI | InChI=1S/C15H20O/c1-5-10(2)11-6-7-13-12(8-11)14(16)9-15(13,3)4/h6-8,10H,5,9H2,1-4H3 |
| InChIKey | DMTARSKYAWNGRR-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |