C18H30NO19S3-3 — CID 59097212
[6-carboxy-5-ethyl-4-hydroxy-2-[[4-hydroxy-6-(methoxymethyl)-5-(sulfonatoamino)-2-(sulfonatooxymethyl)oxan-3-yl]methoxymethyl]oxan-3-yl] sulfate (PubChem CID 59097212) has the molecular formula C18H30NO19S3-3 and a molecular weight of 660.63 g/mol. Its IUPAC name is [6-carboxy-5-ethyl-4-hydroxy-2-[[4-hydroxy-6-(methoxymethyl)-5-(sulfonatoamino)-2-(sulfonatooxymethyl)oxan-3-yl]methoxymethyl]oxan-3-yl] sulfate.
| Compound Name | [6-carboxy-5-ethyl-4-hydroxy-2-[[4-hydroxy-6-(methoxymethyl)-5-(sulfonatoamino)-2-(sulfonatooxymethyl)oxan-3-yl]methoxymethyl]oxan-3-yl] sulfate |
|---|---|
| PubChem CID | 59097212 |
| Molecular Formula | C18H30NO19S3-3 |
| Molecular Weight | 660.63 g/mol |
| Exact Mass | 660.06 |
| IUPAC Name | [6-carboxy-5-ethyl-4-hydroxy-2-[[4-hydroxy-6-(methoxymethyl)-5-(sulfonatoamino)-2-(sulfonatooxymethyl)oxan-3-yl]methoxymethyl]oxan-3-yl] sulfate |
| SMILES | CCC1C(C(=O)O)OC(COCC2C(COS(=O)(=O)[O-])OC(COC)C(NS(=O)(=O)[O-])C2O)C(OS(=O)(=O)[O-])C1O |
| InChI | InChI=1S/C18H33NO19S3/c1-3-8-15(21)17(38-41(30,31)32)12(37-16(8)18(22)23)6-34-4-9-10(7-35-40(27,28)29)36-11(5-33-2)13(14(9)20)19-39(24,25)26/h8-17,19-21H,3-7H2,1-2H3,(H,22,23)(H,24,25,26)(H,27,28,29)(H,30,31,32)/p-3 |
| InChIKey | FRIXVZKXLMWVFK-UHFFFAOYSA-K |
| XLogP | -4.63 |
| TPSA | 316.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.63 |
| LogP ≤ 5 | -4.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|