C18H33NO18S3 — CID 59064324
(3S,4R,6R)-3-(hydroxymethyl)-6-[[(3S,4S,6R)-6-(hydroxymethyl)-5-(sulfoamino)-4-sulfooxy-2-(sulfooxymethyl)oxan-3-yl]methoxymethyl]-4,5-dimethyloxane-2-carboxylic acid (PubChem CID 59064324) has the molecular formula C18H33NO18S3 and a molecular weight of 647.65 g/mol. Its IUPAC name is (3S,4R,6R)-3-(hydroxymethyl)-6-[[(3S,4S,6R)-6-(hydroxymethyl)-5-(sulfoamino)-4-sulfooxy-2-(sulfooxymethyl)oxan-3-yl]methoxymethyl]-4,5-dimethyloxane-2-carboxylic acid.
| Compound Name | (3S,4R,6R)-3-(hydroxymethyl)-6-[[(3S,4S,6R)-6-(hydroxymethyl)-5-(sulfoamino)-4-sulfooxy-2-(sulfooxymethyl)oxan-3-yl]methoxymethyl]-4,5-dimethyloxane-2-carboxylic acid |
|---|---|
| PubChem CID | 59064324 |
| Molecular Formula | C18H33NO18S3 |
| Molecular Weight | 647.65 g/mol |
| Exact Mass | 647.09 |
| IUPAC Name | (3S,4R,6R)-3-(hydroxymethyl)-6-[[(3S,4S,6R)-6-(hydroxymethyl)-5-(sulfoamino)-4-sulfooxy-2-(sulfooxymethyl)oxan-3-yl]methoxymethyl]-4,5-dimethyloxane-2-carboxylic acid |
| SMILES | CC1[C@H](COC[C@H]2C(COS(=O)(=O)O)O[C@@H](CO)C(NS(=O)(=O)O)[C@H]2OS(=O)(=O)O)OC(C(=O)O)[C@H](CO)[C@@H]1C |
| InChI | InChI=1S/C18H33NO18S3/c1-8-9(2)13(36-17(18(22)23)10(8)3-20)6-33-5-11-14(7-34-39(27,28)29)35-12(4-21)15(19-38(24,25)26)16(11)37-40(30,31)32/h8-17,19-21H,3-7H2,1-2H3,(H,22,23)(H,24,25,26)(H,27,28,29)(H,30,31,32)/t8-,9?,10-,11+,12+,13+,14?,15?,16+,17?/m1/s1 |
| InChIKey | PRZQCNDHYUHVJI-WNPSIHBNSA-N |
| XLogP | -3.12 |
| TPSA | 299.05 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.65 |
| LogP ≤ 5 | -3.12 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|