C20H37NO17S3 — CID 88547909
(3R,4R,6S)-6-(2-ethoxyethyl)-3-[(2S,4R,5S)-5-ethyl-4-methyl-3-(sulfoamino)-6-(sulfooxymethyl)oxan-2-yl]oxy-4-methyl-5-sulfooxyoxane-2-carboxylic acid (PubChem CID 88547909) has the molecular formula C20H37NO17S3 and a molecular weight of 659.71 g/mol. Its IUPAC name is (3R,4R,6S)-6-(2-ethoxyethyl)-3-[(2S,4R,5S)-5-ethyl-4-methyl-3-(sulfoamino)-6-(sulfooxymethyl)oxan-2-yl]oxy-4-methyl-5-sulfooxyoxane-2-carboxylic acid.
| Compound Name | (3R,4R,6S)-6-(2-ethoxyethyl)-3-[(2S,4R,5S)-5-ethyl-4-methyl-3-(sulfoamino)-6-(sulfooxymethyl)oxan-2-yl]oxy-4-methyl-5-sulfooxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 88547909 |
| Molecular Formula | C20H37NO17S3 |
| Molecular Weight | 659.71 g/mol |
| Exact Mass | 659.12 |
| IUPAC Name | (3R,4R,6S)-6-(2-ethoxyethyl)-3-[(2S,4R,5S)-5-ethyl-4-methyl-3-(sulfoamino)-6-(sulfooxymethyl)oxan-2-yl]oxy-4-methyl-5-sulfooxyoxane-2-carboxylic acid |
| SMILES | CCOCC[C@@H]1OC(C(=O)O)[C@H](O[C@@H]2OC(COS(=O)(=O)O)[C@@H](CC)[C@@H](C)C2NS(=O)(=O)O)C(C)C1OS(=O)(=O)O |
| InChI | InChI=1S/C20H37NO17S3/c1-5-12-10(3)15(21-39(24,25)26)20(36-14(12)9-34-40(27,28)29)37-17-11(4)16(38-41(30,31)32)13(7-8-33-6-2)35-18(17)19(22)23/h10-18,20-21H,5-9H2,1-4H3,(H,22,23)(H,24,25,26)(H,27,28,29)(H,30,31,32)/t10-,11?,12+,13+,14?,15?,16?,17-,18?,20+/m1/s1 |
| InChIKey | XVYLURRRKJIJSY-HHEZADHKSA-N |
| XLogP | -0.56 |
| TPSA | 267.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.71 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|