C13H15ClNO+ — CID 59097245
8-chloro-1-ethyl-3,9-dimethyl-1H-quinolizin-5-ium-4-one (PubChem CID 59097245) has the molecular formula C13H15ClNO+ and a molecular weight of 236.72 g/mol. Its IUPAC name is 8-chloro-1-ethyl-3,9-dimethyl-1H-quinolizin-5-ium-4-one.
| Compound Name | 8-chloro-1-ethyl-3,9-dimethyl-1H-quinolizin-5-ium-4-one |
|---|---|
| PubChem CID | 59097245 |
| Molecular Formula | C13H15ClNO+ |
| Molecular Weight | 236.72 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | 8-chloro-1-ethyl-3,9-dimethyl-1H-quinolizin-5-ium-4-one |
| SMILES | CCC1C=C(C)C(=O)[n+]2ccc(Cl)c(C)c21 |
| InChI | InChI=1S/C13H15ClNO/c1-4-10-7-8(2)13(16)15-6-5-11(14)9(3)12(10)15/h5-7,10H,4H2,1-3H3/q+1 |
| InChIKey | UZJTZDXWMQLGRO-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 20.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.72 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyl_het_A(9)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|