C23H23ClN2O — CID 118721928
(E)-1-[4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidin-1-yl]but-2-en-1-one (PubChem CID 118721928) has the molecular formula C23H23ClN2O and a molecular weight of 378.90 g/mol. Its IUPAC name is (E)-1-[4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidin-1-yl]but-2-en-1-one.
| Compound Name | (E)-1-[4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidin-1-yl]but-2-en-1-one |
|---|---|
| PubChem CID | 118721928 |
| Molecular Formula | C23H23ClN2O |
| Molecular Weight | 378.90 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | (E)-1-[4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidin-1-yl]but-2-en-1-one |
| SMILES | C/C=C/C(=O)N1CCC(=C2c3ccc(Cl)cc3CCc3cccnc32)CC1 |
| InChI | InChI=1S/C23H23ClN2O/c1-2-4-21(27)26-13-10-16(11-14-26)22-20-9-8-19(24)15-18(20)7-6-17-5-3-12-25-23(17)22/h2-5,8-9,12,15H,6-7,10-11,13-14H2,1H3/b4-2+ |
| InChIKey | MOFVGVFZWIHAPO-DUXPYHPUSA-N |
| XLogP | 4.83 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.90 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|