C28H30N2O2S2 — CID 59097442
[6-tert-butyl-4-(1,3-diphenyl-2-sulfanylidene-1,3-diazinan-5-ylidene)thiopyran-2-yl] propanoate (PubChem CID 59097442) has the molecular formula C28H30N2O2S2 and a molecular weight of 490.69 g/mol. Its IUPAC name is [6-tert-butyl-4-(1,3-diphenyl-2-sulfanylidene-1,3-diazinan-5-ylidene)thiopyran-2-yl] propanoate.
| Compound Name | [6-tert-butyl-4-(1,3-diphenyl-2-sulfanylidene-1,3-diazinan-5-ylidene)thiopyran-2-yl] propanoate |
|---|---|
| PubChem CID | 59097442 |
| Molecular Formula | C28H30N2O2S2 |
| Molecular Weight | 490.69 g/mol |
| Exact Mass | 490.17 |
| IUPAC Name | [6-tert-butyl-4-(1,3-diphenyl-2-sulfanylidene-1,3-diazinan-5-ylidene)thiopyran-2-yl] propanoate |
| SMILES | CCC(=O)OC1=CC(=C2CN(c3ccccc3)C(=S)N(c3ccccc3)C2)C=C(C(C)(C)C)S1 |
| InChI | InChI=1S/C28H30N2O2S2/c1-5-25(31)32-26-17-20(16-24(34-26)28(2,3)4)21-18-29(22-12-8-6-9-13-22)27(33)30(19-21)23-14-10-7-11-15-23/h6-17H,5,18-19H2,1-4H3 |
| InChIKey | KERUDHZFLBLIMY-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.69 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|