C25H20N2O6S3 — CID 20727600
[2-(4,6-dioxo-1,3-diphenyl-2-sulfanylidene-1,3-diazinan-5-ylidene)-5-propanoyloxy-1,3-dithiol-4-yl] propanoate (PubChem CID 20727600) has the molecular formula C25H20N2O6S3 and a molecular weight of 540.64 g/mol. Its IUPAC name is [2-(4,6-dioxo-1,3-diphenyl-2-sulfanylidene-1,3-diazinan-5-ylidene)-5-propanoyloxy-1,3-dithiol-4-yl] propanoate.
| Compound Name | [2-(4,6-dioxo-1,3-diphenyl-2-sulfanylidene-1,3-diazinan-5-ylidene)-5-propanoyloxy-1,3-dithiol-4-yl] propanoate |
|---|---|
| PubChem CID | 20727600 |
| Molecular Formula | C25H20N2O6S3 |
| Molecular Weight | 540.64 g/mol |
| Exact Mass | 540.05 |
| IUPAC Name | [2-(4,6-dioxo-1,3-diphenyl-2-sulfanylidene-1,3-diazinan-5-ylidene)-5-propanoyloxy-1,3-dithiol-4-yl] propanoate |
| SMILES | CCC(=O)OC1=C(OC(=O)CC)SC(=C2C(=O)N(c3ccccc3)C(=S)N(c3ccccc3)C2=O)S1 |
| InChI | InChI=1S/C25H20N2O6S3/c1-3-17(28)32-22-23(33-18(29)4-2)36-24(35-22)19-20(30)26(15-11-7-5-8-12-15)25(34)27(21(19)31)16-13-9-6-10-14-16/h5-14H,3-4H2,1-2H3 |
| InChIKey | GMFXZHPOQYAGPI-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.64 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|