About azanide;[1-(dihydroxymethyl)cyclopropyl]methanediol;platinum(2+)
azanide;[1-(dihydroxymethyl)cyclopropyl]methanediol;platinum(2+) (PubChem CID 59097801) has the molecular formula C5H14N2O4Pt
and a molecular weight of 361.26 g/mol. Its IUPAC name is azanide;[1-(dihydroxymethyl)cyclopropyl]methanediol;platinum(2+).
Molecular Properties
| Compound Name | azanide;[1-(dihydroxymethyl)cyclopropyl]methanediol;platinum(2+) |
| PubChem CID | 59097801 |
| Molecular Formula | C5H14N2O4Pt |
| Molecular Weight | 361.26 g/mol |
| Exact Mass | 361.06 |
| IUPAC Name | azanide;[1-(dihydroxymethyl)cyclopropyl]methanediol;platinum(2+) |
| SMILES | OC(O)C1(C(O)O)CC1.[NH2-].[NH2-].[Pt+2] |
| InChI | InChI=1S/C5H10O4.2H2N.Pt/c6-3(7)5(1-2-5)4(8)9;;;/h3-4,6-9H,1-2H2;2*1H2;/q;2*-1;+2 |
| InChIKey | OKJRFOWRGKSAIU-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 147.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.26 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze azanide;[1-(dihydroxymethyl)cyclopropyl]methanediol;platinum(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azanide;[1-(dihydroxymethyl)cyclopropyl]methanediol;platinum(2+)?
The IUPAC name of azanide;[1-(dihydroxymethyl)cyclopropyl]methanediol;platinum(2+) (CID 59097801) is azanide;[1-(dihydroxymethyl)cyclopropyl]methanediol;platinum(2+).
What is the SMILES notation for azanide;[1-(dihydroxymethyl)cyclopropyl]methanediol;platinum(2+)?
The canonical SMILES for azanide;[1-(dihydroxymethyl)cyclopropyl]methanediol;platinum(2+) is OC(O)C1(C(O)O)CC1.[NH2-].[NH2-].[Pt+2].
What is the InChIKey of azanide;[1-(dihydroxymethyl)cyclopropyl]methanediol;platinum(2+)?
The InChIKey is OKJRFOWRGKSAIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O4.2H2N.Pt/c6-3(7)5(1-2-5)4(8)9;;;/h3-4,6-9H,1-2H2;2*1H2;/q;2*-1;+2.
What are the key properties of azanide;[1-(dihydroxymethyl)cyclopropyl]methanediol;platinum(2+)?
azanide;[1-(dihydroxymethyl)cyclopropyl]methanediol;platinum(2+) has a molecular weight of 361.26 g/mol, XLogP of -0.18, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azanide;[1-(dihydroxymethyl)cyclopropyl]methanediol;platinum(2+) is sourced from PubChem (CID 59097801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).