C8H6NSY- — CID 59098054
2-methyl-7H-1,3-benzothiazol-7-ide;yttrium (PubChem CID 59098054) has the molecular formula C8H6NSY- and a molecular weight of 237.12 g/mol. Its IUPAC name is 2-methyl-7H-1,3-benzothiazol-7-ide;yttrium.
| Compound Name | 2-methyl-7H-1,3-benzothiazol-7-ide;yttrium |
|---|---|
| PubChem CID | 59098054 |
| Molecular Formula | C8H6NSY- |
| Molecular Weight | 237.12 g/mol |
| Exact Mass | 236.93 |
| IUPAC Name | 2-methyl-7H-1,3-benzothiazol-7-ide;yttrium |
| SMILES | Cc1nc2ccc[c-]c2s1.[Y] |
| InChI | InChI=1S/C8H6NS.Y/c1-6-9-7-4-2-3-5-8(7)10-6;/h2-4H,1H3;/q-1; |
| InChIKey | OVULLEOHVSMXBH-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.12 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|