About 3-methyl-5H-quinolin-5-ide;yttrium
3-methyl-5H-quinolin-5-ide;yttrium (PubChem CID 59098079) has the molecular formula C10H8NY-
and a molecular weight of 231.09 g/mol. Its IUPAC name is 3-methyl-5H-quinolin-5-ide;yttrium.
Molecular Properties
| Compound Name | 3-methyl-5H-quinolin-5-ide;yttrium |
| PubChem CID | 59098079 |
| Molecular Formula | C10H8NY- |
| Molecular Weight | 231.09 g/mol |
| Exact Mass | 230.97 |
| IUPAC Name | 3-methyl-5H-quinolin-5-ide;yttrium |
| SMILES | Cc1cnc2ccc[c-]c2c1.[Y] |
| InChI | InChI=1S/C10H8N.Y/c1-8-6-9-4-2-3-5-10(9)11-7-8;/h2-3,5-7H,1H3;/q-1; |
| InChIKey | RXIUXEVZVBOZRT-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.09 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-5H-quinolin-5-ide;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-5H-quinolin-5-ide;yttrium?
The IUPAC name of 3-methyl-5H-quinolin-5-ide;yttrium (CID 59098079) is 3-methyl-5H-quinolin-5-ide;yttrium.
What is the SMILES notation for 3-methyl-5H-quinolin-5-ide;yttrium?
The canonical SMILES for 3-methyl-5H-quinolin-5-ide;yttrium is Cc1cnc2ccc[c-]c2c1.[Y].
What is the InChIKey of 3-methyl-5H-quinolin-5-ide;yttrium?
The InChIKey is RXIUXEVZVBOZRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N.Y/c1-8-6-9-4-2-3-5-10(9)11-7-8;/h2-3,5-7H,1H3;/q-1;.
What are the key properties of 3-methyl-5H-quinolin-5-ide;yttrium?
3-methyl-5H-quinolin-5-ide;yttrium has a molecular weight of 231.09 g/mol, XLogP of 2.34, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-5H-quinolin-5-ide;yttrium is sourced from PubChem (CID 59098079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).