C15H26O5 — CID 59100050
methyl (E)-5-[(4S,5R)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-propylpent-4-enoate (PubChem CID 59100050) has the molecular formula C15H26O5 and a molecular weight of 286.37 g/mol. Its IUPAC name is methyl (E)-5-[(4S,5R)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-propylpent-4-enoate.
| Compound Name | methyl (E)-5-[(4S,5R)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-propylpent-4-enoate |
|---|---|
| PubChem CID | 59100050 |
| Molecular Formula | C15H26O5 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | methyl (E)-5-[(4S,5R)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-propylpent-4-enoate |
| SMILES | CCCC(C/C=C/[C@@H]1OC(C)(C)O[C@@H]1CO)C(=O)OC |
| InChI | InChI=1S/C15H26O5/c1-5-7-11(14(17)18-4)8-6-9-12-13(10-16)20-15(2,3)19-12/h6,9,11-13,16H,5,7-8,10H2,1-4H3/b9-6+/t11?,12-,13+/m0/s1 |
| InChIKey | JXKLHIHZOZZZJY-UNFZWTEESA-N |
| XLogP | 2.03 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|