C13H20N2O4 — CID 59100752
ethyl (E,4S)-4-acetamido-5-[(3S)-2-oxopyrrolidin-3-yl]pent-2-enoate (PubChem CID 59100752) has the molecular formula C13H20N2O4 and a molecular weight of 268.31 g/mol. Its IUPAC name is ethyl (E,4S)-4-acetamido-5-[(3S)-2-oxopyrrolidin-3-yl]pent-2-enoate.
| Compound Name | ethyl (E,4S)-4-acetamido-5-[(3S)-2-oxopyrrolidin-3-yl]pent-2-enoate |
|---|---|
| PubChem CID | 59100752 |
| Molecular Formula | C13H20N2O4 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | ethyl (E,4S)-4-acetamido-5-[(3S)-2-oxopyrrolidin-3-yl]pent-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@H](C[C@@H]1CCNC1=O)NC(C)=O |
| InChI | InChI=1S/C13H20N2O4/c1-3-19-12(17)5-4-11(15-9(2)16)8-10-6-7-14-13(10)18/h4-5,10-11H,3,6-8H2,1-2H3,(H,14,18)(H,15,16)/b5-4+/t10-,11+/m0/s1 |
| InChIKey | LBOAWTVNJISCCE-BXXZLRJFSA-N |
| XLogP | 0.14 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|