C31H30NO2P — CID 59101158
[2-[(4S)-2-methyl-4,5-dihydro-1,3-oxazol-4-yl]-1,3-diphenylpropan-2-yl]oxy-diphenylphosphane (PubChem CID 59101158) has the molecular formula C31H30NO2P and a molecular weight of 479.56 g/mol. Its IUPAC name is [2-[(4S)-2-methyl-4,5-dihydro-1,3-oxazol-4-yl]-1,3-diphenylpropan-2-yl]oxy-diphenylphosphane.
| Compound Name | [2-[(4S)-2-methyl-4,5-dihydro-1,3-oxazol-4-yl]-1,3-diphenylpropan-2-yl]oxy-diphenylphosphane |
|---|---|
| PubChem CID | 59101158 |
| Molecular Formula | C31H30NO2P |
| Molecular Weight | 479.56 g/mol |
| Exact Mass | 479.20 |
| IUPAC Name | [2-[(4S)-2-methyl-4,5-dihydro-1,3-oxazol-4-yl]-1,3-diphenylpropan-2-yl]oxy-diphenylphosphane |
| SMILES | CC1=N[C@H](C(Cc2ccccc2)(Cc2ccccc2)OP(c2ccccc2)c2ccccc2)CO1 |
| InChI | InChI=1S/C31H30NO2P/c1-25-32-30(24-33-25)31(22-26-14-6-2-7-15-26,23-27-16-8-3-9-17-27)34-35(28-18-10-4-11-19-28)29-20-12-5-13-21-29/h2-21,30H,22-24H2,1H3/t30-/m0/s1 |
| InChIKey | LDPOMDFRFKEOPT-PMERELPUSA-N |
| XLogP | 6.09 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.56 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|