C20H27N5O3 — CID 59101961
6-tert-butyl-3-[1-(4-nitrophenoxy)hexyl]-5H-pyrazolo[5,1-c][1,2,4]triazole (PubChem CID 59101961) has the molecular formula C20H27N5O3 and a molecular weight of 385.47 g/mol. Its IUPAC name is 6-tert-butyl-3-[1-(4-nitrophenoxy)hexyl]-5H-pyrazolo[5,1-c][1,2,4]triazole.
| Compound Name | 6-tert-butyl-3-[1-(4-nitrophenoxy)hexyl]-5H-pyrazolo[5,1-c][1,2,4]triazole |
|---|---|
| PubChem CID | 59101961 |
| Molecular Formula | C20H27N5O3 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.21 |
| IUPAC Name | 6-tert-butyl-3-[1-(4-nitrophenoxy)hexyl]-5H-pyrazolo[5,1-c][1,2,4]triazole |
| SMILES | CCCCCC(Oc1ccc([N+](=O)[O-])cc1)c1nnc2cc(C(C)(C)C)[nH]n12 |
| InChI | InChI=1S/C20H27N5O3/c1-5-6-7-8-16(28-15-11-9-14(10-12-15)25(26)27)19-22-21-18-13-17(20(2,3)4)23-24(18)19/h9-13,16,23H,5-8H2,1-4H3 |
| InChIKey | QHNQMAOKMHLHFL-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 98.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|