C7H11AuO2S2 — CID 59102050
1,4-dioxa-8-thiaspiro[4.5]decane-7-thiolate;gold(1+) (PubChem CID 59102050) has the molecular formula C7H11AuO2S2 and a molecular weight of 388.26 g/mol. Its IUPAC name is 1,4-dioxa-8-thiaspiro[4.5]decane-7-thiolate;gold(1+).
| Compound Name | 1,4-dioxa-8-thiaspiro[4.5]decane-7-thiolate;gold(1+) |
|---|---|
| PubChem CID | 59102050 |
| Molecular Formula | C7H11AuO2S2 |
| Molecular Weight | 388.26 g/mol |
| Exact Mass | 387.99 |
| IUPAC Name | 1,4-dioxa-8-thiaspiro[4.5]decane-7-thiolate;gold(1+) |
| SMILES | [Au+].[S-]C1CC2(CCS1)OCCO2 |
| InChI | InChI=1S/C7H12O2S2.Au/c10-6-5-7(1-4-11-6)8-2-3-9-7;/h6,10H,1-5H2;/q;+1/p-1 |
| InChIKey | MVZAQVLHAWFCJT-UHFFFAOYSA-M |
| XLogP | 1.13 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.26 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|