C9H16O2S2 — CID 24812664
4-(1,3-dithian-2-yl)-2,2-dimethyl-1,3-dioxolane (PubChem CID 24812664) has the molecular formula C9H16O2S2 and a molecular weight of 220.36 g/mol. Its IUPAC name is 4-(1,3-dithian-2-yl)-2,2-dimethyl-1,3-dioxolane.
| Compound Name | 4-(1,3-dithian-2-yl)-2,2-dimethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 24812664 |
| Molecular Formula | C9H16O2S2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.06 |
| IUPAC Name | 4-(1,3-dithian-2-yl)-2,2-dimethyl-1,3-dioxolane |
| SMILES | CC1(C)OCC(C2SCCCS2)O1 |
| InChI | InChI=1S/C9H16O2S2/c1-9(2)10-6-7(11-9)8-12-4-3-5-13-8/h7-8H,3-6H2,1-2H3 |
| InChIKey | SSYFVHVVGXEXKU-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |