C8H14O2S2 — CID 22186288
2,8-dimethyl-1,9-dioxa-4,6-dithiaspiro[4.5]decane (PubChem CID 22186288) has the molecular formula C8H14O2S2 and a molecular weight of 206.33 g/mol. Its IUPAC name is 2,8-dimethyl-1,9-dioxa-4,6-dithiaspiro[4.5]decane.
| Compound Name | 2,8-dimethyl-1,9-dioxa-4,6-dithiaspiro[4.5]decane |
|---|---|
| PubChem CID | 22186288 |
| Molecular Formula | C8H14O2S2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.04 |
| IUPAC Name | 2,8-dimethyl-1,9-dioxa-4,6-dithiaspiro[4.5]decane |
| SMILES | CC1CSC2(CO1)OC(C)CS2 |
| InChI | InChI=1S/C8H14O2S2/c1-6-3-11-8(5-9-6)10-7(2)4-12-8/h6-7H,3-5H2,1-2H3 |
| InChIKey | SRBRUYRMSSQNEE-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |