C8H14NO5P — CID 59102717
methyl-[3-(5-methyl-3-oxo-1,2-oxazolidin-2-yl)-2-oxopropyl]phosphinic acid (PubChem CID 59102717) has the molecular formula C8H14NO5P and a molecular weight of 235.18 g/mol. Its IUPAC name is methyl-[3-(5-methyl-3-oxo-1,2-oxazolidin-2-yl)-2-oxopropyl]phosphinic acid.
| Compound Name | methyl-[3-(5-methyl-3-oxo-1,2-oxazolidin-2-yl)-2-oxopropyl]phosphinic acid |
|---|---|
| PubChem CID | 59102717 |
| Molecular Formula | C8H14NO5P |
| Molecular Weight | 235.18 g/mol |
| Exact Mass | 235.06 |
| IUPAC Name | methyl-[3-(5-methyl-3-oxo-1,2-oxazolidin-2-yl)-2-oxopropyl]phosphinic acid |
| SMILES | CC1CC(=O)N(CC(=O)CP(C)(=O)O)O1 |
| InChI | InChI=1S/C8H14NO5P/c1-6-3-8(11)9(14-6)4-7(10)5-15(2,12)13/h6H,3-5H2,1-2H3,(H,12,13) |
| InChIKey | PADMUHVAXARKFC-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.18 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|